C24H26ClN3O2 — CID 7288751
[(2R)-2-[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]pyrrolidin-1-yl]-(4-pentylphenyl)methanone (PubChem CID 7288751) has the molecular formula C24H26ClN3O2 and a molecular weight of 423.94 g/mol. Its IUPAC name is [(2R)-2-[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]pyrrolidin-1-yl]-(4-pentylphenyl)methanone.
| Compound Name | [(2R)-2-[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]pyrrolidin-1-yl]-(4-pentylphenyl)methanone |
|---|---|
| PubChem CID | 7288751 |
| Molecular Formula | C24H26ClN3O2 |
| Molecular Weight | 423.94 g/mol |
| Exact Mass | 423.17 |
| IUPAC Name | [(2R)-2-[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]pyrrolidin-1-yl]-(4-pentylphenyl)methanone |
| SMILES | CCCCCc1ccc(C(=O)N2CCC[C@@H]2c2nc(-c3cccc(Cl)c3)no2)cc1 |
| InChI | InChI=1S/C24H26ClN3O2/c1-2-3-4-7-17-11-13-18(14-12-17)24(29)28-15-6-10-21(28)23-26-22(27-30-23)19-8-5-9-20(25)16-19/h5,8-9,11-14,16,21H,2-4,6-7,10,15H2,1H3/t21-/m1/s1 |
| InChIKey | NPUJKSFPSVRRPB-OAQYLSRUSA-N |
| XLogP | 6.10 |
| TPSA | 59.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.94 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|