C24H27N3O2 — CID 7331197
(4-pentylphenyl)-[(2R)-2-(3-phenyl-1,2,4-oxadiazol-5-yl)pyrrolidin-1-yl]methanone (PubChem CID 7331197) has the molecular formula C24H27N3O2 and a molecular weight of 389.50 g/mol. Its IUPAC name is (4-pentylphenyl)-[(2R)-2-(3-phenyl-1,2,4-oxadiazol-5-yl)pyrrolidin-1-yl]methanone.
| Compound Name | (4-pentylphenyl)-[(2R)-2-(3-phenyl-1,2,4-oxadiazol-5-yl)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 7331197 |
| Molecular Formula | C24H27N3O2 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.21 |
| IUPAC Name | (4-pentylphenyl)-[(2R)-2-(3-phenyl-1,2,4-oxadiazol-5-yl)pyrrolidin-1-yl]methanone |
| SMILES | CCCCCc1ccc(C(=O)N2CCC[C@@H]2c2nc(-c3ccccc3)no2)cc1 |
| InChI | InChI=1S/C24H27N3O2/c1-2-3-5-9-18-13-15-20(16-14-18)24(28)27-17-8-12-21(27)23-25-22(26-29-23)19-10-6-4-7-11-19/h4,6-7,10-11,13-16,21H,2-3,5,8-9,12,17H2,1H3/t21-/m1/s1 |
| InChIKey | OTDSEWDZPSHHHV-OAQYLSRUSA-N |
| XLogP | 5.45 |
| TPSA | 59.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|