C24H27N3O3 — CID 7289199
(4-butoxyphenyl)-[(2S)-2-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]pyrrolidin-1-yl]methanone (PubChem CID 7289199) has the molecular formula C24H27N3O3 and a molecular weight of 405.50 g/mol. Its IUPAC name is (4-butoxyphenyl)-[(2S)-2-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]pyrrolidin-1-yl]methanone.
| Compound Name | (4-butoxyphenyl)-[(2S)-2-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 7289199 |
| Molecular Formula | C24H27N3O3 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | (4-butoxyphenyl)-[(2S)-2-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]pyrrolidin-1-yl]methanone |
| SMILES | CCCCOc1ccc(C(=O)N2CCC[C@H]2c2nc(-c3ccc(C)cc3)no2)cc1 |
| InChI | InChI=1S/C24H27N3O3/c1-3-4-16-29-20-13-11-19(12-14-20)24(28)27-15-5-6-21(27)23-25-22(26-30-23)18-9-7-17(2)8-10-18/h7-14,21H,3-6,15-16H2,1-2H3/t21-/m0/s1 |
| InChIKey | WXIWQZWJQDRIRP-NRFANRHFSA-N |
| XLogP | 5.20 |
| TPSA | 68.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|