C20H23ClN4O3 — CID 3582952
N-[2-[2-[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]piperidin-1-yl]-2-oxoethyl]-N-prop-2-enylacetamide (PubChem CID 3582952) has the molecular formula C20H23ClN4O3 and a molecular weight of 402.88 g/mol. Its IUPAC name is N-[2-[2-[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]piperidin-1-yl]-2-oxoethyl]-N-prop-2-enylacetamide.
| Compound Name | N-[2-[2-[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]piperidin-1-yl]-2-oxoethyl]-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 3582952 |
| Molecular Formula | C20H23ClN4O3 |
| Molecular Weight | 402.88 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | N-[2-[2-[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]piperidin-1-yl]-2-oxoethyl]-N-prop-2-enylacetamide |
| SMILES | C=CCN(CC(=O)N1CCCCC1c1nc(-c2cccc(Cl)c2)no1)C(C)=O |
| InChI | InChI=1S/C20H23ClN4O3/c1-3-10-24(14(2)26)13-18(27)25-11-5-4-9-17(25)20-22-19(23-28-20)15-7-6-8-16(21)12-15/h3,6-8,12,17H,1,4-5,9-11,13H2,2H3 |
| InChIKey | BGQADZZMCLXPGT-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 79.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.88 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|