C26H26Cl2N4O3 — CID 4618288
2-chloro-N-[2-[2-[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]piperidin-1-yl]-2-oxoethyl]-2-phenyl-N-prop-2-enylacetamide (PubChem CID 4618288) has the molecular formula C26H26Cl2N4O3 and a molecular weight of 513.43 g/mol. Its IUPAC name is 2-chloro-N-[2-[2-[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]piperidin-1-yl]-2-oxoethyl]-2-phenyl-N-prop-2-enylacetamide.
| Compound Name | 2-chloro-N-[2-[2-[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]piperidin-1-yl]-2-oxoethyl]-2-phenyl-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 4618288 |
| Molecular Formula | C26H26Cl2N4O3 |
| Molecular Weight | 513.43 g/mol |
| Exact Mass | 512.14 |
| IUPAC Name | 2-chloro-N-[2-[2-[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]piperidin-1-yl]-2-oxoethyl]-2-phenyl-N-prop-2-enylacetamide |
| SMILES | C=CCN(CC(=O)N1CCCCC1c1nc(-c2cccc(Cl)c2)no1)C(=O)C(Cl)c1ccccc1 |
| InChI | InChI=1S/C26H26Cl2N4O3/c1-2-14-31(26(34)23(28)18-9-4-3-5-10-18)17-22(33)32-15-7-6-13-21(32)25-29-24(30-35-25)19-11-8-12-20(27)16-19/h2-5,8-12,16,21,23H,1,6-7,13-15,17H2 |
| InChIKey | NMKPXTQDTZHZBI-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 79.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.43 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|