C18H22FN3O2 — CID 7236978
1-[(2R)-2-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]pyrrolidin-1-yl]hexan-1-one (PubChem CID 7236978) has the molecular formula C18H22FN3O2 and a molecular weight of 331.39 g/mol. Its IUPAC name is 1-[(2R)-2-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]pyrrolidin-1-yl]hexan-1-one.
| Compound Name | 1-[(2R)-2-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]pyrrolidin-1-yl]hexan-1-one |
|---|---|
| PubChem CID | 7236978 |
| Molecular Formula | C18H22FN3O2 |
| Molecular Weight | 331.39 g/mol |
| Exact Mass | 331.17 |
| IUPAC Name | 1-[(2R)-2-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]pyrrolidin-1-yl]hexan-1-one |
| SMILES | CCCCCC(=O)N1CCC[C@@H]1c1nc(-c2ccc(F)cc2)no1 |
| InChI | InChI=1S/C18H22FN3O2/c1-2-3-4-7-16(23)22-12-5-6-15(22)18-20-17(21-24-18)13-8-10-14(19)11-9-13/h8-11,15H,2-7,12H2,1H3/t15-/m1/s1 |
| InChIKey | KFJXEKSSFRAUOE-OAHLLOKOSA-N |
| XLogP | 4.12 |
| TPSA | 59.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.39 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|