C17H19ClFN3O2 — CID 4559091
3-chloro-1-[2-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]pyrrolidin-1-yl]-2,2-dimethylpropan-1-one (PubChem CID 4559091) has the molecular formula C17H19ClFN3O2 and a molecular weight of 351.81 g/mol. Its IUPAC name is 3-chloro-1-[2-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]pyrrolidin-1-yl]-2,2-dimethylpropan-1-one.
| Compound Name | 3-chloro-1-[2-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]pyrrolidin-1-yl]-2,2-dimethylpropan-1-one |
|---|---|
| PubChem CID | 4559091 |
| Molecular Formula | C17H19ClFN3O2 |
| Molecular Weight | 351.81 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | 3-chloro-1-[2-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]pyrrolidin-1-yl]-2,2-dimethylpropan-1-one |
| SMILES | CC(C)(CCl)C(=O)N1CCCC1c1nc(-c2ccc(F)cc2)no1 |
| InChI | InChI=1S/C17H19ClFN3O2/c1-17(2,10-18)16(23)22-9-3-4-13(22)15-20-14(21-24-15)11-5-7-12(19)8-6-11/h5-8,13H,3-4,9-10H2,1-2H3 |
| InChIKey | GAEXJZJXIJPJPM-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 59.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.81 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|