C13H18ClNO2S — CID 61384264
2-(3-chlorophenyl)-1-propylsulfonylpyrrolidine (PubChem CID 61384264) has the molecular formula C13H18ClNO2S and a molecular weight of 287.81 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-1-propylsulfonylpyrrolidine.
| Compound Name | 2-(3-chlorophenyl)-1-propylsulfonylpyrrolidine |
|---|---|
| PubChem CID | 61384264 |
| Molecular Formula | C13H18ClNO2S |
| Molecular Weight | 287.81 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | 2-(3-chlorophenyl)-1-propylsulfonylpyrrolidine |
| SMILES | CCCS(=O)(=O)N1CCCC1c1cccc(Cl)c1 |
| InChI | InChI=1S/C13H18ClNO2S/c1-2-9-18(16,17)15-8-4-7-13(15)11-5-3-6-12(14)10-11/h3,5-6,10,13H,2,4,7-9H2,1H3 |
| InChIKey | JLHBZOFBOMFTIF-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.81 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |