C12H15Cl2NO2S — CID 61356195
2-(3,4-dichlorophenyl)-1-ethylsulfonylpyrrolidine (PubChem CID 61356195) has the molecular formula C12H15Cl2NO2S and a molecular weight of 308.23 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-1-ethylsulfonylpyrrolidine.
| Compound Name | 2-(3,4-dichlorophenyl)-1-ethylsulfonylpyrrolidine |
|---|---|
| PubChem CID | 61356195 |
| Molecular Formula | C12H15Cl2NO2S |
| Molecular Weight | 308.23 g/mol |
| Exact Mass | 307.02 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-1-ethylsulfonylpyrrolidine |
| SMILES | CCS(=O)(=O)N1CCCC1c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H15Cl2NO2S/c1-2-18(16,17)15-7-3-4-12(15)9-5-6-10(13)11(14)8-9/h5-6,8,12H,2-4,7H2,1H3 |
| InChIKey | RKKPRHMPSVBFJH-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.23 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |