C11H14ClNO2S — CID 51694759
(2S)-2-(4-chlorophenyl)-1-methylsulfonylpyrrolidine (PubChem CID 51694759) has the molecular formula C11H14ClNO2S and a molecular weight of 259.76 g/mol. Its IUPAC name is (2S)-2-(4-chlorophenyl)-1-methylsulfonylpyrrolidine.
| Compound Name | (2S)-2-(4-chlorophenyl)-1-methylsulfonylpyrrolidine |
|---|---|
| PubChem CID | 51694759 |
| Molecular Formula | C11H14ClNO2S |
| Molecular Weight | 259.76 g/mol |
| Exact Mass | 259.04 |
| IUPAC Name | (2S)-2-(4-chlorophenyl)-1-methylsulfonylpyrrolidine |
| SMILES | CS(=O)(=O)N1CCC[C@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C11H14ClNO2S/c1-16(14,15)13-8-2-3-11(13)9-4-6-10(12)7-5-9/h4-7,11H,2-3,8H2,1H3/t11-/m0/s1 |
| InChIKey | LUYOMKADQZRQPY-NSHDSACASA-N |
| XLogP | 2.44 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.76 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |