C17H21ClN2O3S — CID 53096247
4-[2-(4-chlorophenyl)azepan-1-yl]sulfonyl-3,5-dimethyl-1,2-oxazole (PubChem CID 53096247) has the molecular formula C17H21ClN2O3S and a molecular weight of 368.89 g/mol. Its IUPAC name is 4-[2-(4-chlorophenyl)azepan-1-yl]sulfonyl-3,5-dimethyl-1,2-oxazole.
| Compound Name | 4-[2-(4-chlorophenyl)azepan-1-yl]sulfonyl-3,5-dimethyl-1,2-oxazole |
|---|---|
| PubChem CID | 53096247 |
| Molecular Formula | C17H21ClN2O3S |
| Molecular Weight | 368.89 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | 4-[2-(4-chlorophenyl)azepan-1-yl]sulfonyl-3,5-dimethyl-1,2-oxazole |
| SMILES | Cc1noc(C)c1S(=O)(=O)N1CCCCCC1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H21ClN2O3S/c1-12-17(13(2)23-19-12)24(21,22)20-11-5-3-4-6-16(20)14-7-9-15(18)10-8-14/h7-10,16H,3-6,11H2,1-2H3 |
| InChIKey | LPFBCFUGMUUEFS-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 63.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.89 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |