C15H20N2O3S2 — CID 93076643
3,5-dimethyl-4-[(2S)-2-thiophen-2-ylazepan-1-yl]sulfonyl-1,2-oxazole (PubChem CID 93076643) has the molecular formula C15H20N2O3S2 and a molecular weight of 340.47 g/mol. Its IUPAC name is 3,5-dimethyl-4-[(2S)-2-thiophen-2-ylazepan-1-yl]sulfonyl-1,2-oxazole.
| Compound Name | 3,5-dimethyl-4-[(2S)-2-thiophen-2-ylazepan-1-yl]sulfonyl-1,2-oxazole |
|---|---|
| PubChem CID | 93076643 |
| Molecular Formula | C15H20N2O3S2 |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | 3,5-dimethyl-4-[(2S)-2-thiophen-2-ylazepan-1-yl]sulfonyl-1,2-oxazole |
| SMILES | Cc1noc(C)c1S(=O)(=O)N1CCCCC[C@H]1c1cccs1 |
| InChI | InChI=1S/C15H20N2O3S2/c1-11-15(12(2)20-16-11)22(18,19)17-9-5-3-4-7-13(17)14-8-6-10-21-14/h6,8,10,13H,3-5,7,9H2,1-2H3/t13-/m0/s1 |
| InChIKey | OOWTWEUSQDXFTG-ZDUSSCGKSA-N |
| XLogP | 3.66 |
| TPSA | 63.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |