C16H19NO2S2 — CID 22586782
1-(benzenesulfonyl)-2-thiophen-2-ylazepane (PubChem CID 22586782) has the molecular formula C16H19NO2S2 and a molecular weight of 321.47 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-2-thiophen-2-ylazepane.
| Compound Name | 1-(benzenesulfonyl)-2-thiophen-2-ylazepane |
|---|---|
| PubChem CID | 22586782 |
| Molecular Formula | C16H19NO2S2 |
| Molecular Weight | 321.47 g/mol |
| Exact Mass | 321.09 |
| IUPAC Name | 1-(benzenesulfonyl)-2-thiophen-2-ylazepane |
| SMILES | O=S(=O)(c1ccccc1)N1CCCCCC1c1cccs1 |
| InChI | InChI=1S/C16H19NO2S2/c18-21(19,14-8-3-1-4-9-14)17-12-6-2-5-10-15(17)16-11-7-13-20-16/h1,3-4,7-9,11,13,15H,2,5-6,10,12H2 |
| InChIKey | LAAVELCDGLZORH-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.47 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |