C16H19NO4S2 — CID 26821437
(2S)-1-(3,4-dimethoxyphenyl)sulfonyl-2-thiophen-2-ylpyrrolidine (PubChem CID 26821437) has the molecular formula C16H19NO4S2 and a molecular weight of 353.47 g/mol. Its IUPAC name is (2S)-1-(3,4-dimethoxyphenyl)sulfonyl-2-thiophen-2-ylpyrrolidine.
| Compound Name | (2S)-1-(3,4-dimethoxyphenyl)sulfonyl-2-thiophen-2-ylpyrrolidine |
|---|---|
| PubChem CID | 26821437 |
| Molecular Formula | C16H19NO4S2 |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.08 |
| IUPAC Name | (2S)-1-(3,4-dimethoxyphenyl)sulfonyl-2-thiophen-2-ylpyrrolidine |
| SMILES | COc1ccc(S(=O)(=O)N2CCC[C@H]2c2cccs2)cc1OC |
| InChI | InChI=1S/C16H19NO4S2/c1-20-14-8-7-12(11-15(14)21-2)23(18,19)17-9-3-5-13(17)16-6-4-10-22-16/h4,6-8,10-11,13H,3,5,9H2,1-2H3/t13-/m0/s1 |
| InChIKey | WKWDJVADUYVDMM-ZDUSSCGKSA-N |
| XLogP | 3.29 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |