C20H24ClNO4S — CID 95079108
(2R)-2-(4-chlorophenyl)-1-(3,4-dimethoxyphenyl)sulfonylazepane (PubChem CID 95079108) has the molecular formula C20H24ClNO4S and a molecular weight of 409.94 g/mol. Its IUPAC name is (2R)-2-(4-chlorophenyl)-1-(3,4-dimethoxyphenyl)sulfonylazepane.
| Compound Name | (2R)-2-(4-chlorophenyl)-1-(3,4-dimethoxyphenyl)sulfonylazepane |
|---|---|
| PubChem CID | 95079108 |
| Molecular Formula | C20H24ClNO4S |
| Molecular Weight | 409.94 g/mol |
| Exact Mass | 409.11 |
| IUPAC Name | (2R)-2-(4-chlorophenyl)-1-(3,4-dimethoxyphenyl)sulfonylazepane |
| SMILES | COc1ccc(S(=O)(=O)N2CCCCC[C@@H]2c2ccc(Cl)cc2)cc1OC |
| InChI | InChI=1S/C20H24ClNO4S/c1-25-19-12-11-17(14-20(19)26-2)27(23,24)22-13-5-3-4-6-18(22)15-7-9-16(21)10-8-15/h7-12,14,18H,3-6,13H2,1-2H3/t18-/m1/s1 |
| InChIKey | RGZIMNYMQQLPDL-GOSISDBHSA-N |
| XLogP | 4.66 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.94 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |