C19H22ClNO2S — CID 95078859
(2S)-1-(4-chlorophenyl)sulfonyl-2-(3-methylphenyl)azepane (PubChem CID 95078859) has the molecular formula C19H22ClNO2S and a molecular weight of 363.91 g/mol. Its IUPAC name is (2S)-1-(4-chlorophenyl)sulfonyl-2-(3-methylphenyl)azepane.
| Compound Name | (2S)-1-(4-chlorophenyl)sulfonyl-2-(3-methylphenyl)azepane |
|---|---|
| PubChem CID | 95078859 |
| Molecular Formula | C19H22ClNO2S |
| Molecular Weight | 363.91 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | (2S)-1-(4-chlorophenyl)sulfonyl-2-(3-methylphenyl)azepane |
| SMILES | Cc1cccc([C@@H]2CCCCCN2S(=O)(=O)c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C19H22ClNO2S/c1-15-6-5-7-16(14-15)19-8-3-2-4-13-21(19)24(22,23)18-11-9-17(20)10-12-18/h5-7,9-12,14,19H,2-4,8,13H2,1H3/t19-/m0/s1 |
| InChIKey | VAVSURLHEFUYDE-IBGZPJMESA-N |
| XLogP | 4.95 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.91 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |