C18H22N2O6S2 — CID 25472243
3-[(2R)-2-(3,4-dimethoxyphenyl)pyrrolidin-1-yl]sulfonylbenzenesulfonamide (PubChem CID 25472243) has the molecular formula C18H22N2O6S2 and a molecular weight of 426.52 g/mol. Its IUPAC name is 3-[(2R)-2-(3,4-dimethoxyphenyl)pyrrolidin-1-yl]sulfonylbenzenesulfonamide.
| Compound Name | 3-[(2R)-2-(3,4-dimethoxyphenyl)pyrrolidin-1-yl]sulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 25472243 |
| Molecular Formula | C18H22N2O6S2 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.09 |
| IUPAC Name | 3-[(2R)-2-(3,4-dimethoxyphenyl)pyrrolidin-1-yl]sulfonylbenzenesulfonamide |
| SMILES | COc1ccc([C@H]2CCCN2S(=O)(=O)c2cccc(S(N)(=O)=O)c2)cc1OC |
| InChI | InChI=1S/C18H22N2O6S2/c1-25-17-9-8-13(11-18(17)26-2)16-7-4-10-20(16)28(23,24)15-6-3-5-14(12-15)27(19,21)22/h3,5-6,8-9,11-12,16H,4,7,10H2,1-2H3,(H2,19,21,22)/t16-/m1/s1 |
| InChIKey | ULTZCFXMQYWGDA-MRXNPFEDSA-N |
| XLogP | 1.88 |
| TPSA | 116.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |