C17H20N2O5S2 — CID 30287737
3-[(2S)-2-(4-methoxyphenyl)pyrrolidin-1-yl]sulfonylbenzenesulfonamide (PubChem CID 30287737) has the molecular formula C17H20N2O5S2 and a molecular weight of 396.49 g/mol. Its IUPAC name is 3-[(2S)-2-(4-methoxyphenyl)pyrrolidin-1-yl]sulfonylbenzenesulfonamide.
| Compound Name | 3-[(2S)-2-(4-methoxyphenyl)pyrrolidin-1-yl]sulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 30287737 |
| Molecular Formula | C17H20N2O5S2 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.08 |
| IUPAC Name | 3-[(2S)-2-(4-methoxyphenyl)pyrrolidin-1-yl]sulfonylbenzenesulfonamide |
| SMILES | COc1ccc([C@@H]2CCCN2S(=O)(=O)c2cccc(S(N)(=O)=O)c2)cc1 |
| InChI | InChI=1S/C17H20N2O5S2/c1-24-14-9-7-13(8-10-14)17-6-3-11-19(17)26(22,23)16-5-2-4-15(12-16)25(18,20)21/h2,4-5,7-10,12,17H,3,6,11H2,1H3,(H2,18,20,21)/t17-/m0/s1 |
| InChIKey | XTRICSGAVUBFMW-KRWDZBQOSA-N |
| XLogP | 1.87 |
| TPSA | 106.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |