C20H23NO3S — CID 134017312
1-(2,3-dihydro-1H-inden-5-ylsulfonyl)-2-(4-methoxyphenyl)pyrrolidine (PubChem CID 134017312) has the molecular formula C20H23NO3S and a molecular weight of 357.47 g/mol. Its IUPAC name is 1-(2,3-dihydro-1H-inden-5-ylsulfonyl)-2-(4-methoxyphenyl)pyrrolidine.
| Compound Name | 1-(2,3-dihydro-1H-inden-5-ylsulfonyl)-2-(4-methoxyphenyl)pyrrolidine |
|---|---|
| PubChem CID | 134017312 |
| Molecular Formula | C20H23NO3S |
| Molecular Weight | 357.47 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | 1-(2,3-dihydro-1H-inden-5-ylsulfonyl)-2-(4-methoxyphenyl)pyrrolidine |
| SMILES | COc1ccc(C2CCCN2S(=O)(=O)c2ccc3c(c2)CCC3)cc1 |
| InChI | InChI=1S/C20H23NO3S/c1-24-18-10-7-16(8-11-18)20-6-3-13-21(20)25(22,23)19-12-9-15-4-2-5-17(15)14-19/h7-12,14,20H,2-6,13H2,1H3 |
| InChIKey | DKLLSXLUUJKGNU-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.47 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |