C18H20FNO5S2 — CID 51967628
(2S)-1-(4-fluoro-3-methylsulfonylphenyl)sulfonyl-2-(4-methoxyphenyl)pyrrolidine (PubChem CID 51967628) has the molecular formula C18H20FNO5S2 and a molecular weight of 413.49 g/mol. Its IUPAC name is (2S)-1-(4-fluoro-3-methylsulfonylphenyl)sulfonyl-2-(4-methoxyphenyl)pyrrolidine.
| Compound Name | (2S)-1-(4-fluoro-3-methylsulfonylphenyl)sulfonyl-2-(4-methoxyphenyl)pyrrolidine |
|---|---|
| PubChem CID | 51967628 |
| Molecular Formula | C18H20FNO5S2 |
| Molecular Weight | 413.49 g/mol |
| Exact Mass | 413.08 |
| IUPAC Name | (2S)-1-(4-fluoro-3-methylsulfonylphenyl)sulfonyl-2-(4-methoxyphenyl)pyrrolidine |
| SMILES | COc1ccc([C@@H]2CCCN2S(=O)(=O)c2ccc(F)c(S(C)(=O)=O)c2)cc1 |
| InChI | InChI=1S/C18H20FNO5S2/c1-25-14-7-5-13(6-8-14)17-4-3-11-20(17)27(23,24)15-9-10-16(19)18(12-15)26(2,21)22/h5-10,12,17H,3-4,11H2,1-2H3/t17-/m0/s1 |
| InChIKey | DGOWAUMUORTOMX-KRWDZBQOSA-N |
| XLogP | 2.76 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.49 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |