C11H14N2O6S2 — CID 78920787
(2R)-1-(3-sulfamoylphenyl)sulfonylpyrrolidine-2-carboxylic acid (PubChem CID 78920787) has the molecular formula C11H14N2O6S2 and a molecular weight of 334.38 g/mol. Its IUPAC name is (2R)-1-(3-sulfamoylphenyl)sulfonylpyrrolidine-2-carboxylic acid.
| Compound Name | (2R)-1-(3-sulfamoylphenyl)sulfonylpyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 78920787 |
| Molecular Formula | C11H14N2O6S2 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.03 |
| IUPAC Name | (2R)-1-(3-sulfamoylphenyl)sulfonylpyrrolidine-2-carboxylic acid |
| SMILES | NS(=O)(=O)c1cccc(S(=O)(=O)N2CCC[C@@H]2C(=O)O)c1 |
| InChI | InChI=1S/C11H14N2O6S2/c12-20(16,17)8-3-1-4-9(7-8)21(18,19)13-6-2-5-10(13)11(14)15/h1,3-4,7,10H,2,5-6H2,(H,14,15)(H2,12,16,17)/t10-/m1/s1 |
| InChIKey | YOPPUSDDDBMJOE-SNVBAGLBSA-N |
| XLogP | -0.43 |
| TPSA | 134.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |