C12H15N3O5S — CID 78923074
(2R)-1-[(3-sulfamoylphenyl)carbamoyl]pyrrolidine-2-carboxylic acid (PubChem CID 78923074) has the molecular formula C12H15N3O5S and a molecular weight of 313.33 g/mol. Its IUPAC name is (2R)-1-[(3-sulfamoylphenyl)carbamoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2R)-1-[(3-sulfamoylphenyl)carbamoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 78923074 |
| Molecular Formula | C12H15N3O5S |
| Molecular Weight | 313.33 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | (2R)-1-[(3-sulfamoylphenyl)carbamoyl]pyrrolidine-2-carboxylic acid |
| SMILES | NS(=O)(=O)c1cccc(NC(=O)N2CCC[C@@H]2C(=O)O)c1 |
| InChI | InChI=1S/C12H15N3O5S/c13-21(19,20)9-4-1-3-8(7-9)14-12(18)15-6-2-5-10(15)11(16)17/h1,3-4,7,10H,2,5-6H2,(H,14,18)(H,16,17)(H2,13,19,20)/t10-/m1/s1 |
| InChIKey | IXUFLJUCOZFZNX-SNVBAGLBSA-N |
| XLogP | 0.41 |
| TPSA | 129.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.33 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |