C13H19N3O3S — CID 47185999
3-methyl-N-(3-sulfamoylphenyl)piperidine-1-carboxamide (PubChem CID 47185999) has the molecular formula C13H19N3O3S and a molecular weight of 297.38 g/mol. Its IUPAC name is 3-methyl-N-(3-sulfamoylphenyl)piperidine-1-carboxamide.
| Compound Name | 3-methyl-N-(3-sulfamoylphenyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 47185999 |
| Molecular Formula | C13H19N3O3S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | 3-methyl-N-(3-sulfamoylphenyl)piperidine-1-carboxamide |
| SMILES | CC1CCCN(C(=O)Nc2cccc(S(N)(=O)=O)c2)C1 |
| InChI | InChI=1S/C13H19N3O3S/c1-10-4-3-7-16(9-10)13(17)15-11-5-2-6-12(8-11)20(14,18)19/h2,5-6,8,10H,3-4,7,9H2,1H3,(H,15,17)(H2,14,18,19) |
| InChIKey | UIADWKBHTNLQPP-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |