C13H20N4O3S — CID 79158927
4-methyl-N-[3-(sulfamoylamino)phenyl]piperidine-1-carboxamide (PubChem CID 79158927) has the molecular formula C13H20N4O3S and a molecular weight of 312.39 g/mol. Its IUPAC name is 4-methyl-N-[3-(sulfamoylamino)phenyl]piperidine-1-carboxamide.
| Compound Name | 4-methyl-N-[3-(sulfamoylamino)phenyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 79158927 |
| Molecular Formula | C13H20N4O3S |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | 4-methyl-N-[3-(sulfamoylamino)phenyl]piperidine-1-carboxamide |
| SMILES | CC1CCN(C(=O)Nc2cccc(NS(N)(=O)=O)c2)CC1 |
| InChI | InChI=1S/C13H20N4O3S/c1-10-5-7-17(8-6-10)13(18)15-11-3-2-4-12(9-11)16-21(14,19)20/h2-4,9-10,16H,5-8H2,1H3,(H,15,18)(H2,14,19,20) |
| InChIKey | UBTMCKKOHCSHOY-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |