C15H22N2O6S2 — CID 120782397
1-[3-(diethylsulfamoyl)phenyl]sulfonylpyrrolidine-2-carboxylic acid (PubChem CID 120782397) has the molecular formula C15H22N2O6S2 and a molecular weight of 390.48 g/mol. Its IUPAC name is 1-[3-(diethylsulfamoyl)phenyl]sulfonylpyrrolidine-2-carboxylic acid.
| Compound Name | 1-[3-(diethylsulfamoyl)phenyl]sulfonylpyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 120782397 |
| Molecular Formula | C15H22N2O6S2 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.09 |
| IUPAC Name | 1-[3-(diethylsulfamoyl)phenyl]sulfonylpyrrolidine-2-carboxylic acid |
| SMILES | CCN(CC)S(=O)(=O)c1cccc(S(=O)(=O)N2CCCC2C(=O)O)c1 |
| InChI | InChI=1S/C15H22N2O6S2/c1-3-16(4-2)24(20,21)12-7-5-8-13(11-12)25(22,23)17-10-6-9-14(17)15(18)19/h5,7-8,11,14H,3-4,6,9-10H2,1-2H3,(H,18,19) |
| InChIKey | GQOVVJSNOKPNFZ-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 112.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |