C16H21ClN2O5S — CID 41273093
(2S)-1-[2-chloro-5-(diethylsulfamoyl)benzoyl]pyrrolidine-2-carboxylic acid (PubChem CID 41273093) has the molecular formula C16H21ClN2O5S and a molecular weight of 388.87 g/mol. Its IUPAC name is (2S)-1-[2-chloro-5-(diethylsulfamoyl)benzoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-1-[2-chloro-5-(diethylsulfamoyl)benzoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 41273093 |
| Molecular Formula | C16H21ClN2O5S |
| Molecular Weight | 388.87 g/mol |
| Exact Mass | 388.09 |
| IUPAC Name | (2S)-1-[2-chloro-5-(diethylsulfamoyl)benzoyl]pyrrolidine-2-carboxylic acid |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(Cl)c(C(=O)N2CCC[C@H]2C(=O)O)c1 |
| InChI | InChI=1S/C16H21ClN2O5S/c1-3-18(4-2)25(23,24)11-7-8-13(17)12(10-11)15(20)19-9-5-6-14(19)16(21)22/h7-8,10,14H,3-6,9H2,1-2H3,(H,21,22)/t14-/m0/s1 |
| InChIKey | RIYINDGGHPJVFE-AWEZNQCLSA-N |
| XLogP | 2.06 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.87 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |