C23H27ClN2O4S — CID 26080208
3-(4-benzoylpiperidine-1-carbonyl)-4-chloro-N,N-diethylbenzenesulfonamide (PubChem CID 26080208) has the molecular formula C23H27ClN2O4S and a molecular weight of 463.00 g/mol. Its IUPAC name is 3-(4-benzoylpiperidine-1-carbonyl)-4-chloro-N,N-diethylbenzenesulfonamide.
| Compound Name | 3-(4-benzoylpiperidine-1-carbonyl)-4-chloro-N,N-diethylbenzenesulfonamide |
|---|---|
| PubChem CID | 26080208 |
| Molecular Formula | C23H27ClN2O4S |
| Molecular Weight | 463.00 g/mol |
| Exact Mass | 462.14 |
| IUPAC Name | 3-(4-benzoylpiperidine-1-carbonyl)-4-chloro-N,N-diethylbenzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(Cl)c(C(=O)N2CCC(C(=O)c3ccccc3)CC2)c1 |
| InChI | InChI=1S/C23H27ClN2O4S/c1-3-26(4-2)31(29,30)19-10-11-21(24)20(16-19)23(28)25-14-12-18(13-15-25)22(27)17-8-6-5-7-9-17/h5-11,16,18H,3-4,12-15H2,1-2H3 |
| InChIKey | PIAFAZDSLOADCU-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.00 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |