C23H28N2O4S — CID 18143310
3-(4-benzoylpiperidine-1-carbonyl)-N,N-diethylbenzenesulfonamide (PubChem CID 18143310) has the molecular formula C23H28N2O4S and a molecular weight of 428.55 g/mol. Its IUPAC name is 3-(4-benzoylpiperidine-1-carbonyl)-N,N-diethylbenzenesulfonamide.
| Compound Name | 3-(4-benzoylpiperidine-1-carbonyl)-N,N-diethylbenzenesulfonamide |
|---|---|
| PubChem CID | 18143310 |
| Molecular Formula | C23H28N2O4S |
| Molecular Weight | 428.55 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | 3-(4-benzoylpiperidine-1-carbonyl)-N,N-diethylbenzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1cccc(C(=O)N2CCC(C(=O)c3ccccc3)CC2)c1 |
| InChI | InChI=1S/C23H28N2O4S/c1-3-25(4-2)30(28,29)21-12-8-11-20(17-21)23(27)24-15-13-19(14-16-24)22(26)18-9-6-5-7-10-18/h5-12,17,19H,3-4,13-16H2,1-2H3 |
| InChIKey | VHJBJDCXFLIMBU-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.55 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |