C19H28N2O5S — CID 46684274
ethyl 1-[3-(diethylsulfamoyl)benzoyl]piperidine-3-carboxylate (PubChem CID 46684274) has the molecular formula C19H28N2O5S and a molecular weight of 396.51 g/mol. Its IUPAC name is ethyl 1-[3-(diethylsulfamoyl)benzoyl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[3-(diethylsulfamoyl)benzoyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 46684274 |
| Molecular Formula | C19H28N2O5S |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | ethyl 1-[3-(diethylsulfamoyl)benzoyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(C(=O)c2cccc(S(=O)(=O)N(CC)CC)c2)C1 |
| InChI | InChI=1S/C19H28N2O5S/c1-4-21(5-2)27(24,25)17-11-7-9-15(13-17)18(22)20-12-8-10-16(14-20)19(23)26-6-3/h7,9,11,13,16H,4-6,8,10,12,14H2,1-3H3 |
| InChIKey | QMWFCZSZGJBCLV-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |