C29H32N2O6S — CID 93472681
ethyl (3S)-1-[3-[benzyl-(2-methoxyphenyl)sulfamoyl]benzoyl]piperidine-3-carboxylate (PubChem CID 93472681) has the molecular formula C29H32N2O6S and a molecular weight of 536.65 g/mol. Its IUPAC name is ethyl (3S)-1-[3-[benzyl-(2-methoxyphenyl)sulfamoyl]benzoyl]piperidine-3-carboxylate.
| Compound Name | ethyl (3S)-1-[3-[benzyl-(2-methoxyphenyl)sulfamoyl]benzoyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 93472681 |
| Molecular Formula | C29H32N2O6S |
| Molecular Weight | 536.65 g/mol |
| Exact Mass | 536.20 |
| IUPAC Name | ethyl (3S)-1-[3-[benzyl-(2-methoxyphenyl)sulfamoyl]benzoyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@H]1CCCN(C(=O)c2cccc(S(=O)(=O)N(Cc3ccccc3)c3ccccc3OC)c2)C1 |
| InChI | InChI=1S/C29H32N2O6S/c1-3-37-29(33)24-14-10-18-30(21-24)28(32)23-13-9-15-25(19-23)38(34,35)31(20-22-11-5-4-6-12-22)26-16-7-8-17-27(26)36-2/h4-9,11-13,15-17,19,24H,3,10,14,18,20-21H2,1-2H3/t24-/m0/s1 |
| InChIKey | GDDPSVGNXFHLDT-DEOSSOPVSA-N |
| XLogP | 4.51 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.65 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |