C20H31N3O3S — CID 60559058
N,N-diethyl-3-(3-pyrrolidin-1-ylpiperidine-1-carbonyl)benzenesulfonamide (PubChem CID 60559058) has the molecular formula C20H31N3O3S and a molecular weight of 393.55 g/mol. Its IUPAC name is N,N-diethyl-3-(3-pyrrolidin-1-ylpiperidine-1-carbonyl)benzenesulfonamide.
| Compound Name | N,N-diethyl-3-(3-pyrrolidin-1-ylpiperidine-1-carbonyl)benzenesulfonamide |
|---|---|
| PubChem CID | 60559058 |
| Molecular Formula | C20H31N3O3S |
| Molecular Weight | 393.55 g/mol |
| Exact Mass | 393.21 |
| IUPAC Name | N,N-diethyl-3-(3-pyrrolidin-1-ylpiperidine-1-carbonyl)benzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1cccc(C(=O)N2CCCC(N3CCCC3)C2)c1 |
| InChI | InChI=1S/C20H31N3O3S/c1-3-23(4-2)27(25,26)19-11-7-9-17(15-19)20(24)22-14-8-10-18(16-22)21-12-5-6-13-21/h7,9,11,15,18H,3-6,8,10,12-14,16H2,1-2H3 |
| InChIKey | BAHZHJOEFYIOQQ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.55 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |