C17H23FN2O — CID 95333696
(3-fluorophenyl)-[(3R)-3-pyrrolidin-1-ylazepan-1-yl]methanone (PubChem CID 95333696) has the molecular formula C17H23FN2O and a molecular weight of 290.38 g/mol. Its IUPAC name is (3-fluorophenyl)-[(3R)-3-pyrrolidin-1-ylazepan-1-yl]methanone.
| Compound Name | (3-fluorophenyl)-[(3R)-3-pyrrolidin-1-ylazepan-1-yl]methanone |
|---|---|
| PubChem CID | 95333696 |
| Molecular Formula | C17H23FN2O |
| Molecular Weight | 290.38 g/mol |
| Exact Mass | 290.18 |
| IUPAC Name | (3-fluorophenyl)-[(3R)-3-pyrrolidin-1-ylazepan-1-yl]methanone |
| SMILES | O=C(c1cccc(F)c1)N1CCCC[C@@H](N2CCCC2)C1 |
| InChI | InChI=1S/C17H23FN2O/c18-15-7-5-6-14(12-15)17(21)20-11-2-1-8-16(13-20)19-9-3-4-10-19/h5-7,12,16H,1-4,8-11,13H2/t16-/m1/s1 |
| InChIKey | XDHKFQKOKGBTTC-MRXNPFEDSA-N |
| XLogP | 2.92 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.38 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |