C11H12FNO2 — CID 66261910
(3-fluorophenyl)-[(3R)-3-hydroxypyrrolidin-1-yl]methanone (PubChem CID 66261910) has the molecular formula C11H12FNO2 and a molecular weight of 209.22 g/mol. Its IUPAC name is (3-fluorophenyl)-[(3R)-3-hydroxypyrrolidin-1-yl]methanone.
| Compound Name | (3-fluorophenyl)-[(3R)-3-hydroxypyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 66261910 |
| Molecular Formula | C11H12FNO2 |
| Molecular Weight | 209.22 g/mol |
| Exact Mass | 209.09 |
| IUPAC Name | (3-fluorophenyl)-[(3R)-3-hydroxypyrrolidin-1-yl]methanone |
| SMILES | O=C(c1cccc(F)c1)N1CC[C@@H](O)C1 |
| InChI | InChI=1S/C11H12FNO2/c12-9-3-1-2-8(6-9)11(15)13-5-4-10(14)7-13/h1-3,6,10,14H,4-5,7H2/t10-/m1/s1 |
| InChIKey | XMVANFBXQNMZGD-SNVBAGLBSA-N |
| XLogP | 1.03 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.22 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |