C11H10F3NO2 — CID 65100423
(3-hydroxypyrrolidin-1-yl)-(2,4,6-trifluorophenyl)methanone (PubChem CID 65100423) has the molecular formula C11H10F3NO2 and a molecular weight of 245.20 g/mol. Its IUPAC name is (3-hydroxypyrrolidin-1-yl)-(2,4,6-trifluorophenyl)methanone.
| Compound Name | (3-hydroxypyrrolidin-1-yl)-(2,4,6-trifluorophenyl)methanone |
|---|---|
| PubChem CID | 65100423 |
| Molecular Formula | C11H10F3NO2 |
| Molecular Weight | 245.20 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | (3-hydroxypyrrolidin-1-yl)-(2,4,6-trifluorophenyl)methanone |
| SMILES | O=C(c1c(F)cc(F)cc1F)N1CCC(O)C1 |
| InChI | InChI=1S/C11H10F3NO2/c12-6-3-8(13)10(9(14)4-6)11(17)15-2-1-7(16)5-15/h3-4,7,16H,1-2,5H2 |
| InChIKey | BUHFVJRPSNPIDZ-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.20 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |