C18H23FN2O2 — CID 3769094
[1-(3-fluorobenzoyl)piperidin-3-yl]-piperidin-1-ylmethanone (PubChem CID 3769094) has the molecular formula C18H23FN2O2 and a molecular weight of 318.39 g/mol. Its IUPAC name is [1-(3-fluorobenzoyl)piperidin-3-yl]-piperidin-1-ylmethanone.
| Compound Name | [1-(3-fluorobenzoyl)piperidin-3-yl]-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 3769094 |
| Molecular Formula | C18H23FN2O2 |
| Molecular Weight | 318.39 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | [1-(3-fluorobenzoyl)piperidin-3-yl]-piperidin-1-ylmethanone |
| SMILES | O=C(c1cccc(F)c1)N1CCCC(C(=O)N2CCCCC2)C1 |
| InChI | InChI=1S/C18H23FN2O2/c19-16-8-4-6-14(12-16)17(22)21-11-5-7-15(13-21)18(23)20-9-2-1-3-10-20/h4,6,8,12,15H,1-3,5,7,9-11,13H2 |
| InChIKey | LEORBTNGBIKLJK-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.39 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |