C19H25ClN2O2 — CID 662429
azepan-1-yl-[1-(3-chlorobenzoyl)piperidin-3-yl]methanone (PubChem CID 662429) has the molecular formula C19H25ClN2O2 and a molecular weight of 348.87 g/mol. Its IUPAC name is azepan-1-yl-[1-(3-chlorobenzoyl)piperidin-3-yl]methanone.
| Compound Name | azepan-1-yl-[1-(3-chlorobenzoyl)piperidin-3-yl]methanone |
|---|---|
| PubChem CID | 662429 |
| Molecular Formula | C19H25ClN2O2 |
| Molecular Weight | 348.87 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | azepan-1-yl-[1-(3-chlorobenzoyl)piperidin-3-yl]methanone |
| SMILES | O=C(c1cccc(Cl)c1)N1CCCC(C(=O)N2CCCCCC2)C1 |
| InChI | InChI=1S/C19H25ClN2O2/c20-17-9-5-7-15(13-17)18(23)22-12-6-8-16(14-22)19(24)21-10-3-1-2-4-11-21/h5,7,9,13,16H,1-4,6,8,10-12,14H2 |
| InChIKey | BLCNXKPJQFQGAC-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.87 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |