C25H30ClN3O2 — CID 93060233
(3R)-N-(1-benzylpiperidin-4-yl)-1-(3-chlorobenzoyl)piperidine-3-carboxamide (PubChem CID 93060233) has the molecular formula C25H30ClN3O2 and a molecular weight of 439.99 g/mol. Its IUPAC name is (3R)-N-(1-benzylpiperidin-4-yl)-1-(3-chlorobenzoyl)piperidine-3-carboxamide.
| Compound Name | (3R)-N-(1-benzylpiperidin-4-yl)-1-(3-chlorobenzoyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 93060233 |
| Molecular Formula | C25H30ClN3O2 |
| Molecular Weight | 439.99 g/mol |
| Exact Mass | 439.20 |
| IUPAC Name | (3R)-N-(1-benzylpiperidin-4-yl)-1-(3-chlorobenzoyl)piperidine-3-carboxamide |
| SMILES | O=C(NC1CCN(Cc2ccccc2)CC1)[C@@H]1CCCN(C(=O)c2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C25H30ClN3O2/c26-22-10-4-8-20(16-22)25(31)29-13-5-9-21(18-29)24(30)27-23-11-14-28(15-12-23)17-19-6-2-1-3-7-19/h1-4,6-8,10,16,21,23H,5,9,11-15,17-18H2,(H,27,30)/t21-/m1/s1 |
| InChIKey | SFLWZLHMZLBPHZ-OAQYLSRUSA-N |
| XLogP | 3.97 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.99 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |