C22H33N3O2 — CID 55882707
N-(1-benzylpiperidin-4-yl)-1-butanoylpiperidine-3-carboxamide (PubChem CID 55882707) has the molecular formula C22H33N3O2 and a molecular weight of 371.53 g/mol. Its IUPAC name is N-(1-benzylpiperidin-4-yl)-1-butanoylpiperidine-3-carboxamide.
| Compound Name | N-(1-benzylpiperidin-4-yl)-1-butanoylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 55882707 |
| Molecular Formula | C22H33N3O2 |
| Molecular Weight | 371.53 g/mol |
| Exact Mass | 371.26 |
| IUPAC Name | N-(1-benzylpiperidin-4-yl)-1-butanoylpiperidine-3-carboxamide |
| SMILES | CCCC(=O)N1CCCC(C(=O)NC2CCN(Cc3ccccc3)CC2)C1 |
| InChI | InChI=1S/C22H33N3O2/c1-2-7-21(26)25-13-6-10-19(17-25)22(27)23-20-11-14-24(15-12-20)16-18-8-4-3-5-9-18/h3-5,8-9,19-20H,2,6-7,10-17H2,1H3,(H,23,27) |
| InChIKey | KMCSTGFPWWDVBP-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.53 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |