C19H20FNO — CID 90608444
(3-fluorophenyl)-(3-phenylazepan-1-yl)methanone (PubChem CID 90608444) has the molecular formula C19H20FNO and a molecular weight of 297.37 g/mol. Its IUPAC name is (3-fluorophenyl)-(3-phenylazepan-1-yl)methanone.
| Compound Name | (3-fluorophenyl)-(3-phenylazepan-1-yl)methanone |
|---|---|
| PubChem CID | 90608444 |
| Molecular Formula | C19H20FNO |
| Molecular Weight | 297.37 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | (3-fluorophenyl)-(3-phenylazepan-1-yl)methanone |
| SMILES | O=C(c1cccc(F)c1)N1CCCCC(c2ccccc2)C1 |
| InChI | InChI=1S/C19H20FNO/c20-18-11-6-10-16(13-18)19(22)21-12-5-4-9-17(14-21)15-7-2-1-3-8-15/h1-3,6-8,10-11,13,17H,4-5,9,12,14H2 |
| InChIKey | MNIAJBVQVJQVLT-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.37 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |