C19H21NO2 — CID 740543
(3-methoxyphenyl)-[(3R)-3-phenylpiperidin-1-yl]methanone (PubChem CID 740543) has the molecular formula C19H21NO2 and a molecular weight of 295.38 g/mol. Its IUPAC name is (3-methoxyphenyl)-[(3R)-3-phenylpiperidin-1-yl]methanone.
| Compound Name | (3-methoxyphenyl)-[(3R)-3-phenylpiperidin-1-yl]methanone |
|---|---|
| PubChem CID | 740543 |
| Molecular Formula | C19H21NO2 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | (3-methoxyphenyl)-[(3R)-3-phenylpiperidin-1-yl]methanone |
| SMILES | COc1cccc(C(=O)N2CCC[C@H](c3ccccc3)C2)c1 |
| InChI | InChI=1S/C19H21NO2/c1-22-18-11-5-9-16(13-18)19(21)20-12-6-10-17(14-20)15-7-3-2-4-8-15/h2-5,7-9,11,13,17H,6,10,12,14H2,1H3/t17-/m0/s1 |
| InChIKey | SBCRDKRHZZAZNS-KRWDZBQOSA-N |
| XLogP | 3.71 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |