C16H22N2O — CID 110441496
(3-methylphenyl)-(3-pyrrolidin-1-ylpyrrolidin-1-yl)methanone (PubChem CID 110441496) has the molecular formula C16H22N2O and a molecular weight of 258.37 g/mol. Its IUPAC name is (3-methylphenyl)-(3-pyrrolidin-1-ylpyrrolidin-1-yl)methanone.
| Compound Name | (3-methylphenyl)-(3-pyrrolidin-1-ylpyrrolidin-1-yl)methanone |
|---|---|
| PubChem CID | 110441496 |
| Molecular Formula | C16H22N2O |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | (3-methylphenyl)-(3-pyrrolidin-1-ylpyrrolidin-1-yl)methanone |
| SMILES | Cc1cccc(C(=O)N2CCC(N3CCCC3)C2)c1 |
| InChI | InChI=1S/C16H22N2O/c1-13-5-4-6-14(11-13)16(19)18-10-7-15(12-18)17-8-2-3-9-17/h4-6,11,15H,2-3,7-10,12H2,1H3 |
| InChIKey | WGRXNVUVXWJGST-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |