C16H21BrN2O — CID 79458515
(3-bromo-4-methylphenyl)-(3-pyrrolidin-1-ylpyrrolidin-1-yl)methanone (PubChem CID 79458515) has the molecular formula C16H21BrN2O and a molecular weight of 337.26 g/mol. Its IUPAC name is (3-bromo-4-methylphenyl)-(3-pyrrolidin-1-ylpyrrolidin-1-yl)methanone.
| Compound Name | (3-bromo-4-methylphenyl)-(3-pyrrolidin-1-ylpyrrolidin-1-yl)methanone |
|---|---|
| PubChem CID | 79458515 |
| Molecular Formula | C16H21BrN2O |
| Molecular Weight | 337.26 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | (3-bromo-4-methylphenyl)-(3-pyrrolidin-1-ylpyrrolidin-1-yl)methanone |
| SMILES | Cc1ccc(C(=O)N2CCC(N3CCCC3)C2)cc1Br |
| InChI | InChI=1S/C16H21BrN2O/c1-12-4-5-13(10-15(12)17)16(20)19-9-6-14(11-19)18-7-2-3-8-18/h4-5,10,14H,2-3,6-9,11H2,1H3 |
| InChIKey | LYNZMCCFENALPQ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.26 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |