C21H23NO4S — CID 41309553
[1-[3-(methylsulfonylmethyl)benzoyl]piperidin-4-yl]-phenylmethanone (PubChem CID 41309553) has the molecular formula C21H23NO4S and a molecular weight of 385.49 g/mol. Its IUPAC name is [1-[3-(methylsulfonylmethyl)benzoyl]piperidin-4-yl]-phenylmethanone.
| Compound Name | [1-[3-(methylsulfonylmethyl)benzoyl]piperidin-4-yl]-phenylmethanone |
|---|---|
| PubChem CID | 41309553 |
| Molecular Formula | C21H23NO4S |
| Molecular Weight | 385.49 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | [1-[3-(methylsulfonylmethyl)benzoyl]piperidin-4-yl]-phenylmethanone |
| SMILES | CS(=O)(=O)Cc1cccc(C(=O)N2CCC(C(=O)c3ccccc3)CC2)c1 |
| InChI | InChI=1S/C21H23NO4S/c1-27(25,26)15-16-6-5-9-19(14-16)21(24)22-12-10-18(11-13-22)20(23)17-7-3-2-4-8-17/h2-9,14,18H,10-13,15H2,1H3 |
| InChIKey | ADUYGWXQVUMCOR-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.49 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |