C15H23ClN2O3S — CID 119488373
[3-(methylamino)piperidin-1-yl]-[3-(methylsulfonylmethyl)phenyl]methanone;hydrochloride (PubChem CID 119488373) has the molecular formula C15H23ClN2O3S and a molecular weight of 346.88 g/mol. Its IUPAC name is [3-(methylamino)piperidin-1-yl]-[3-(methylsulfonylmethyl)phenyl]methanone;hydrochloride.
| Compound Name | [3-(methylamino)piperidin-1-yl]-[3-(methylsulfonylmethyl)phenyl]methanone;hydrochloride |
|---|---|
| PubChem CID | 119488373 |
| Molecular Formula | C15H23ClN2O3S |
| Molecular Weight | 346.88 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | [3-(methylamino)piperidin-1-yl]-[3-(methylsulfonylmethyl)phenyl]methanone;hydrochloride |
| SMILES | CNC1CCCN(C(=O)c2cccc(CS(C)(=O)=O)c2)C1.Cl |
| InChI | InChI=1S/C15H22N2O3S.ClH/c1-16-14-7-4-8-17(10-14)15(18)13-6-3-5-12(9-13)11-21(2,19)20;/h3,5-6,9,14,16H,4,7-8,10-11H2,1-2H3;1H |
| InChIKey | QNSQLAMZUFFMQP-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.88 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |