C16H23N3O3S — CID 119487555
3-[3-(methylamino)piperidine-1-carbonyl]-N-prop-2-enylbenzenesulfonamide (PubChem CID 119487555) has the molecular formula C16H23N3O3S and a molecular weight of 337.45 g/mol. Its IUPAC name is 3-[3-(methylamino)piperidine-1-carbonyl]-N-prop-2-enylbenzenesulfonamide.
| Compound Name | 3-[3-(methylamino)piperidine-1-carbonyl]-N-prop-2-enylbenzenesulfonamide |
|---|---|
| PubChem CID | 119487555 |
| Molecular Formula | C16H23N3O3S |
| Molecular Weight | 337.45 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | 3-[3-(methylamino)piperidine-1-carbonyl]-N-prop-2-enylbenzenesulfonamide |
| SMILES | C=CCNS(=O)(=O)c1cccc(C(=O)N2CCCC(NC)C2)c1 |
| InChI | InChI=1S/C16H23N3O3S/c1-3-9-18-23(21,22)15-8-4-6-13(11-15)16(20)19-10-5-7-14(12-19)17-2/h3-4,6,8,11,14,17-18H,1,5,7,9-10,12H2,2H3 |
| InChIKey | GSXUYAHALOMNQY-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.45 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|