C17H26ClN3O3S — CID 119542651
3-[4-(methylaminomethyl)piperidine-1-carbonyl]-N-prop-2-enylbenzenesulfonamide;hydrochloride (PubChem CID 119542651) has the molecular formula C17H26ClN3O3S and a molecular weight of 387.93 g/mol. Its IUPAC name is 3-[4-(methylaminomethyl)piperidine-1-carbonyl]-N-prop-2-enylbenzenesulfonamide;hydrochloride.
| Compound Name | 3-[4-(methylaminomethyl)piperidine-1-carbonyl]-N-prop-2-enylbenzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 119542651 |
| Molecular Formula | C17H26ClN3O3S |
| Molecular Weight | 387.93 g/mol |
| Exact Mass | 387.14 |
| IUPAC Name | 3-[4-(methylaminomethyl)piperidine-1-carbonyl]-N-prop-2-enylbenzenesulfonamide;hydrochloride |
| SMILES | C=CCNS(=O)(=O)c1cccc(C(=O)N2CCC(CNC)CC2)c1.Cl |
| InChI | InChI=1S/C17H25N3O3S.ClH/c1-3-9-19-24(22,23)16-6-4-5-15(12-16)17(21)20-10-7-14(8-11-20)13-18-2;/h3-6,12,14,18-19H,1,7-11,13H2,2H3;1H |
| InChIKey | CYHXVCCRNYCZMO-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.93 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|