C15H23ClN2O — CID 119545466
[4-(methylaminomethyl)piperidin-1-yl]-(3-methylphenyl)methanone;hydrochloride (PubChem CID 119545466) has the molecular formula C15H23ClN2O and a molecular weight of 282.81 g/mol. Its IUPAC name is [4-(methylaminomethyl)piperidin-1-yl]-(3-methylphenyl)methanone;hydrochloride.
| Compound Name | [4-(methylaminomethyl)piperidin-1-yl]-(3-methylphenyl)methanone;hydrochloride |
|---|---|
| PubChem CID | 119545466 |
| Molecular Formula | C15H23ClN2O |
| Molecular Weight | 282.81 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | [4-(methylaminomethyl)piperidin-1-yl]-(3-methylphenyl)methanone;hydrochloride |
| SMILES | CNCC1CCN(C(=O)c2cccc(C)c2)CC1.Cl |
| InChI | InChI=1S/C15H22N2O.ClH/c1-12-4-3-5-14(10-12)15(18)17-8-6-13(7-9-17)11-16-2;/h3-5,10,13,16H,6-9,11H2,1-2H3;1H |
| InChIKey | CJYMRUPJIKMGCH-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.81 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |