C21H33N3O2 — CID 119544153
3-[4-(methylaminomethyl)piperidine-1-carbonyl]-N,N-dipropylbenzamide (PubChem CID 119544153) has the molecular formula C21H33N3O2 and a molecular weight of 359.51 g/mol. Its IUPAC name is 3-[4-(methylaminomethyl)piperidine-1-carbonyl]-N,N-dipropylbenzamide.
| Compound Name | 3-[4-(methylaminomethyl)piperidine-1-carbonyl]-N,N-dipropylbenzamide |
|---|---|
| PubChem CID | 119544153 |
| Molecular Formula | C21H33N3O2 |
| Molecular Weight | 359.51 g/mol |
| Exact Mass | 359.26 |
| IUPAC Name | 3-[4-(methylaminomethyl)piperidine-1-carbonyl]-N,N-dipropylbenzamide |
| SMILES | CCCN(CCC)C(=O)c1cccc(C(=O)N2CCC(CNC)CC2)c1 |
| InChI | InChI=1S/C21H33N3O2/c1-4-11-23(12-5-2)20(25)18-7-6-8-19(15-18)21(26)24-13-9-17(10-14-24)16-22-3/h6-8,15,17,22H,4-5,9-14,16H2,1-3H3 |
| InChIKey | XXLZEXRQQZZQNO-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.51 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |