C19H24ClN3O3S — CID 119487809
N-[3-[3-(methylamino)piperidine-1-carbonyl]phenyl]benzenesulfonamide;hydrochloride (PubChem CID 119487809) has the molecular formula C19H24ClN3O3S and a molecular weight of 409.94 g/mol. Its IUPAC name is N-[3-[3-(methylamino)piperidine-1-carbonyl]phenyl]benzenesulfonamide;hydrochloride.
| Compound Name | N-[3-[3-(methylamino)piperidine-1-carbonyl]phenyl]benzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 119487809 |
| Molecular Formula | C19H24ClN3O3S |
| Molecular Weight | 409.94 g/mol |
| Exact Mass | 409.12 |
| IUPAC Name | N-[3-[3-(methylamino)piperidine-1-carbonyl]phenyl]benzenesulfonamide;hydrochloride |
| SMILES | CNC1CCCN(C(=O)c2cccc(NS(=O)(=O)c3ccccc3)c2)C1.Cl |
| InChI | InChI=1S/C19H23N3O3S.ClH/c1-20-17-9-6-12-22(14-17)19(23)15-7-5-8-16(13-15)21-26(24,25)18-10-3-2-4-11-18;/h2-5,7-8,10-11,13,17,20-21H,6,9,12,14H2,1H3;1H |
| InChIKey | BTFUHVXYJGZJLN-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.94 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |