C26H33N3O4S — CID 46387322
1-[3-(benzenesulfonamido)benzoyl]-N-cycloheptylpiperidine-3-carboxamide (PubChem CID 46387322) has the molecular formula C26H33N3O4S and a molecular weight of 483.63 g/mol. Its IUPAC name is 1-[3-(benzenesulfonamido)benzoyl]-N-cycloheptylpiperidine-3-carboxamide.
| Compound Name | 1-[3-(benzenesulfonamido)benzoyl]-N-cycloheptylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 46387322 |
| Molecular Formula | C26H33N3O4S |
| Molecular Weight | 483.63 g/mol |
| Exact Mass | 483.22 |
| IUPAC Name | 1-[3-(benzenesulfonamido)benzoyl]-N-cycloheptylpiperidine-3-carboxamide |
| SMILES | O=C(NC1CCCCCC1)C1CCCN(C(=O)c2cccc(NS(=O)(=O)c3ccccc3)c2)C1 |
| InChI | InChI=1S/C26H33N3O4S/c30-25(27-22-12-4-1-2-5-13-22)21-11-9-17-29(19-21)26(31)20-10-8-14-23(18-20)28-34(32,33)24-15-6-3-7-16-24/h3,6-8,10,14-16,18,21-22,28H,1-2,4-5,9,11-13,17,19H2,(H,27,30) |
| InChIKey | QLIAQNDRYNSBGH-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.63 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |